C14H16ClN3O4S — CID 113022491
N-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]methanesulfonamide (PubChem CID 113022491) has the molecular formula C14H16ClN3O4S and a molecular weight of 357.82 g/mol. Its IUPAC name is N-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 113022491 |
| Molecular Formula | C14H16ClN3O4S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]methanesulfonamide |
| SMILES | COc1cc(Nc2ccc(NS(C)(=O)=O)cn2)c(OC)cc1Cl |
| InChI | InChI=1S/C14H16ClN3O4S/c1-21-12-7-11(13(22-2)6-10(12)15)17-14-5-4-9(8-16-14)18-23(3,19)20/h4-8,18H,1-3H3,(H,16,17) |
| InChIKey | XZHPOSSDCIGULE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |