C16H18ClN3O3 — CID 113022533
ethyl N-[6-(4-chloro-2-methoxy-5-methylanilino)-3-pyridinyl]carbamate (PubChem CID 113022533) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is ethyl N-[6-(4-chloro-2-methoxy-5-methylanilino)-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-(4-chloro-2-methoxy-5-methylanilino)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113022533 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | ethyl N-[6-(4-chloro-2-methoxy-5-methylanilino)-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2cc(C)c(Cl)cc2OC)nc1 |
| InChI | InChI=1S/C16H18ClN3O3/c1-4-23-16(21)19-11-5-6-15(18-9-11)20-13-7-10(2)12(17)8-14(13)22-3/h5-9H,4H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | KZLWIELVNKNDPW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |