C16H19N3O2 — CID 110178980
ethyl N-[6-(2,4-dimethylanilino)-3-pyridinyl]carbamate (PubChem CID 110178980) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is ethyl N-[6-(2,4-dimethylanilino)-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-(2,4-dimethylanilino)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 110178980 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | ethyl N-[6-(2,4-dimethylanilino)-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2ccc(C)cc2C)nc1 |
| InChI | InChI=1S/C16H19N3O2/c1-4-21-16(20)18-13-6-8-15(17-10-13)19-14-7-5-11(2)9-12(14)3/h5-10H,4H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | SLTGRIUXZAAYKK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |