C18H23N3O2 — CID 113016805
tert-butyl N-[6-(2,4-dimethylanilino)-3-pyridinyl]carbamate (PubChem CID 113016805) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl N-[6-(2,4-dimethylanilino)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-(2,4-dimethylanilino)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113016805 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | tert-butyl N-[6-(2,4-dimethylanilino)-3-pyridinyl]carbamate |
| SMILES | Cc1ccc(Nc2ccc(NC(=O)OC(C)(C)C)cn2)c(C)c1 |
| InChI | InChI=1S/C18H23N3O2/c1-12-6-8-15(13(2)10-12)21-16-9-7-14(11-19-16)20-17(22)23-18(3,4)5/h6-11H,1-5H3,(H,19,21)(H,20,22) |
| InChIKey | NLYCICOAKCTUDG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |