C15H14F3N3O2 — CID 113020178
ethyl N-[6-[2-(trifluoromethyl)anilino]-3-pyridinyl]carbamate (PubChem CID 113020178) has the molecular formula C15H14F3N3O2 and a molecular weight of 325.29 g/mol. Its IUPAC name is ethyl N-[6-[2-(trifluoromethyl)anilino]-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-[2-(trifluoromethyl)anilino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113020178 |
| Molecular Formula | C15H14F3N3O2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | ethyl N-[6-[2-(trifluoromethyl)anilino]-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2ccccc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C15H14F3N3O2/c1-2-23-14(22)20-10-7-8-13(19-9-10)21-12-6-4-3-5-11(12)15(16,17)18/h3-9H,2H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | XDVKAAYUSUZVDR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |