C18H18N6O2 — CID 110178368
ethyl N-[2-[(6-anilino-3-pyridinyl)amino]pyrimidin-5-yl]carbamate (PubChem CID 110178368) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is ethyl N-[2-[(6-anilino-3-pyridinyl)amino]pyrimidin-5-yl]carbamate.
| Compound Name | ethyl N-[2-[(6-anilino-3-pyridinyl)amino]pyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 110178368 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | ethyl N-[2-[(6-anilino-3-pyridinyl)amino]pyrimidin-5-yl]carbamate |
| SMILES | CCOC(=O)Nc1cnc(Nc2ccc(Nc3ccccc3)nc2)nc1 |
| InChI | InChI=1S/C18H18N6O2/c1-2-26-18(25)24-15-11-20-17(21-12-15)23-14-8-9-16(19-10-14)22-13-6-4-3-5-7-13/h3-12H,2H2,1H3,(H,19,22)(H,24,25)(H,20,21,23) |
| InChIKey | SYFSEJLXQZKPNU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |