C17H20N4O4 — CID 110177011
[[6-[3-(ethoxycarbonylamino)anilino]-3-pyridinyl]amino] propanoate (PubChem CID 110177011) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is [[6-[3-(ethoxycarbonylamino)anilino]-3-pyridinyl]amino] propanoate.
| Compound Name | [[6-[3-(ethoxycarbonylamino)anilino]-3-pyridinyl]amino] propanoate |
|---|---|
| PubChem CID | 110177011 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [[6-[3-(ethoxycarbonylamino)anilino]-3-pyridinyl]amino] propanoate |
| SMILES | CCOC(=O)Nc1cccc(Nc2ccc(NOC(=O)CC)cn2)c1 |
| InChI | InChI=1S/C17H20N4O4/c1-3-16(22)25-21-14-8-9-15(18-11-14)19-12-6-5-7-13(10-12)20-17(23)24-4-2/h5-11,21H,3-4H2,1-2H3,(H,18,19)(H,20,23) |
| InChIKey | AVMXDTMYSMLAOY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|