C14H13Cl2N3O2 — CID 113036803
ethyl N-[5-(3,5-dichloroanilino)-2-pyridinyl]carbamate (PubChem CID 113036803) has the molecular formula C14H13Cl2N3O2 and a molecular weight of 326.18 g/mol. Its IUPAC name is ethyl N-[5-(3,5-dichloroanilino)-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[5-(3,5-dichloroanilino)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113036803 |
| Molecular Formula | C14H13Cl2N3O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | ethyl N-[5-(3,5-dichloroanilino)-2-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2cc(Cl)cc(Cl)c2)cn1 |
| InChI | InChI=1S/C14H13Cl2N3O2/c1-2-21-14(20)19-13-4-3-11(8-17-13)18-12-6-9(15)5-10(16)7-12/h3-8,18H,2H2,1H3,(H,17,19,20) |
| InChIKey | NEVQEKMZNHIBJY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |