C16H17N3O4 — CID 113020771
methyl 4-[[5-(ethoxycarbonylamino)-2-pyridinyl]amino]benzoate (PubChem CID 113020771) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is methyl 4-[[5-(ethoxycarbonylamino)-2-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-[[5-(ethoxycarbonylamino)-2-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 113020771 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | methyl 4-[[5-(ethoxycarbonylamino)-2-pyridinyl]amino]benzoate |
| SMILES | CCOC(=O)Nc1ccc(Nc2ccc(C(=O)OC)cc2)nc1 |
| InChI | InChI=1S/C16H17N3O4/c1-3-23-16(21)19-13-8-9-14(17-10-13)18-12-6-4-11(5-7-12)15(20)22-2/h4-10H,3H2,1-2H3,(H,17,18)(H,19,21) |
| InChIKey | WRSKBNAKZMPVEI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |