C16H19N3O4 — CID 113034657
ethyl N-[5-(2,5-dimethoxyanilino)-2-pyridinyl]carbamate (PubChem CID 113034657) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is ethyl N-[5-(2,5-dimethoxyanilino)-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[5-(2,5-dimethoxyanilino)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113034657 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethyl N-[5-(2,5-dimethoxyanilino)-2-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2cc(OC)ccc2OC)cn1 |
| InChI | InChI=1S/C16H19N3O4/c1-4-23-16(20)19-15-8-5-11(10-17-15)18-13-9-12(21-2)6-7-14(13)22-3/h5-10,18H,4H2,1-3H3,(H,17,19,20) |
| InChIKey | WUNHEWSNTAFETC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |