C18H23N3O3 — CID 113034682
N-[5-(2,4-dimethoxyanilino)-2-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 113034682) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[5-(2,4-dimethoxyanilino)-2-pyridinyl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-(2,4-dimethoxyanilino)-2-pyridinyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 113034682 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[5-(2,4-dimethoxyanilino)-2-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(Nc2ccc(NC(=O)C(C)(C)C)nc2)c(OC)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-18(2,3)17(22)21-16-9-6-12(11-19-16)20-14-8-7-13(23-4)10-15(14)24-5/h6-11,20H,1-5H3,(H,19,21,22) |
| InChIKey | YZWIYWOCZMDESH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |