C20H26N4O3 — CID 113034718
1-cyclohexyl-3-[5-(2,4-dimethoxyanilino)-2-pyridinyl]urea (PubChem CID 113034718) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[5-(2,4-dimethoxyanilino)-2-pyridinyl]urea.
| Compound Name | 1-cyclohexyl-3-[5-(2,4-dimethoxyanilino)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 113034718 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-cyclohexyl-3-[5-(2,4-dimethoxyanilino)-2-pyridinyl]urea |
| SMILES | COc1ccc(Nc2ccc(NC(=O)NC3CCCCC3)nc2)c(OC)c1 |
| InChI | InChI=1S/C20H26N4O3/c1-26-16-9-10-17(18(12-16)27-2)22-15-8-11-19(21-13-15)24-20(25)23-14-6-4-3-5-7-14/h8-14,22H,3-7H2,1-2H3,(H2,21,23,24,25) |
| InChIKey | MDUZGRWYNBMNQR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |