C16H18N4O2 — CID 113034207
1-cyclopropyl-3-[5-(4-methoxyanilino)-2-pyridinyl]urea (PubChem CID 113034207) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-cyclopropyl-3-[5-(4-methoxyanilino)-2-pyridinyl]urea.
| Compound Name | 1-cyclopropyl-3-[5-(4-methoxyanilino)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 113034207 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-cyclopropyl-3-[5-(4-methoxyanilino)-2-pyridinyl]urea |
| SMILES | COc1ccc(Nc2ccc(NC(=O)NC3CC3)nc2)cc1 |
| InChI | InChI=1S/C16H18N4O2/c1-22-14-7-4-11(5-8-14)18-13-6-9-15(17-10-13)20-16(21)19-12-2-3-12/h4-10,12,18H,2-3H2,1H3,(H2,17,19,20,21) |
| InChIKey | GPWZTJHQRBNYJE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |