C20H25ClN4O2 — CID 113036939
1-[5-(4-chloro-2-methoxy-5-methylanilino)-2-pyridinyl]-3-cyclohexylurea (PubChem CID 113036939) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 1-[5-(4-chloro-2-methoxy-5-methylanilino)-2-pyridinyl]-3-cyclohexylurea.
| Compound Name | 1-[5-(4-chloro-2-methoxy-5-methylanilino)-2-pyridinyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 113036939 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-[5-(4-chloro-2-methoxy-5-methylanilino)-2-pyridinyl]-3-cyclohexylurea |
| SMILES | COc1cc(Cl)c(C)cc1Nc1ccc(NC(=O)NC2CCCCC2)nc1 |
| InChI | InChI=1S/C20H25ClN4O2/c1-13-10-17(18(27-2)11-16(13)21)23-15-8-9-19(22-12-15)25-20(26)24-14-6-4-3-5-7-14/h8-12,14,23H,3-7H2,1-2H3,(H2,22,24,25,26) |
| InChIKey | WCRXYEYJZHUOCE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |