C21H20ClN3O3 — CID 113034700
2-(4-chlorophenyl)-N-[5-(2,4-dimethoxyanilino)-2-pyridinyl]acetamide (PubChem CID 113034700) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[5-(2,4-dimethoxyanilino)-2-pyridinyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[5-(2,4-dimethoxyanilino)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 113034700 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[5-(2,4-dimethoxyanilino)-2-pyridinyl]acetamide |
| SMILES | COc1ccc(Nc2ccc(NC(=O)Cc3ccc(Cl)cc3)nc2)c(OC)c1 |
| InChI | InChI=1S/C21H20ClN3O3/c1-27-17-8-9-18(19(12-17)28-2)24-16-7-10-20(23-13-16)25-21(26)11-14-3-5-15(22)6-4-14/h3-10,12-13,24H,11H2,1-2H3,(H,23,25,26) |
| InChIKey | BSMROCQVAHSPIF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |