C21H19F2N3O3 — CID 113036450
N-[5-(2,4-difluoroanilino)-2-pyridinyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 113036450) has the molecular formula C21H19F2N3O3 and a molecular weight of 399.40 g/mol. Its IUPAC name is N-[5-(2,4-difluoroanilino)-2-pyridinyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[5-(2,4-difluoroanilino)-2-pyridinyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113036450 |
| Molecular Formula | C21H19F2N3O3 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-[5-(2,4-difluoroanilino)-2-pyridinyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(Nc3ccc(F)cc3F)cn2)cc1OC |
| InChI | InChI=1S/C21H19F2N3O3/c1-28-18-7-3-13(9-19(18)29-2)10-21(27)26-20-8-5-15(12-24-20)25-17-6-4-14(22)11-16(17)23/h3-9,11-12,25H,10H2,1-2H3,(H,24,26,27) |
| InChIKey | ZSJZFPYNBZHDTA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |