C23H25N3O3 — CID 113032344
2-(3,4-dimethoxyphenyl)-N-[5-(2,3-dimethylanilino)-2-pyridinyl]acetamide (PubChem CID 113032344) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5-(2,3-dimethylanilino)-2-pyridinyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5-(2,3-dimethylanilino)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 113032344 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5-(2,3-dimethylanilino)-2-pyridinyl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(Nc3cccc(C)c3C)cn2)cc1OC |
| InChI | InChI=1S/C23H25N3O3/c1-15-6-5-7-19(16(15)2)25-18-9-11-22(24-14-18)26-23(27)13-17-8-10-20(28-3)21(12-17)29-4/h5-12,14,25H,13H2,1-4H3,(H,24,26,27) |
| InChIKey | DMXKHCWSSASPQP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |