C17H19F2N3O — CID 113036420
N-[5-(2,4-difluoroanilino)-2-pyridinyl]-2-ethylbutanamide (PubChem CID 113036420) has the molecular formula C17H19F2N3O and a molecular weight of 319.36 g/mol. Its IUPAC name is N-[5-(2,4-difluoroanilino)-2-pyridinyl]-2-ethylbutanamide.
| Compound Name | N-[5-(2,4-difluoroanilino)-2-pyridinyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 113036420 |
| Molecular Formula | C17H19F2N3O |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-[5-(2,4-difluoroanilino)-2-pyridinyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(Nc2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C17H19F2N3O/c1-3-11(4-2)17(23)22-16-8-6-13(10-20-16)21-15-7-5-12(18)9-14(15)19/h5-11,21H,3-4H2,1-2H3,(H,20,22,23) |
| InChIKey | JBYLAYOGZXPLAQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |