C19H22ClN3O3 — CID 113035445
methyl 4-chloro-3-[[6-(2-ethylbutanoylamino)-3-pyridinyl]amino]benzoate (PubChem CID 113035445) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is methyl 4-chloro-3-[[6-(2-ethylbutanoylamino)-3-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[6-(2-ethylbutanoylamino)-3-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 113035445 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | methyl 4-chloro-3-[[6-(2-ethylbutanoylamino)-3-pyridinyl]amino]benzoate |
| SMILES | CCC(CC)C(=O)Nc1ccc(Nc2cc(C(=O)OC)ccc2Cl)cn1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-4-12(5-2)18(24)23-17-9-7-14(11-21-17)22-16-10-13(19(25)26-3)6-8-15(16)20/h6-12,22H,4-5H2,1-3H3,(H,21,23,24) |
| InChIKey | VZXGLXJXGUDZFJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |