C18H14ClN3O4 — CID 113035446
methyl 4-chloro-3-[[6-(furan-2-carbonylamino)-3-pyridinyl]amino]benzoate (PubChem CID 113035446) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is methyl 4-chloro-3-[[6-(furan-2-carbonylamino)-3-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[6-(furan-2-carbonylamino)-3-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 113035446 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | methyl 4-chloro-3-[[6-(furan-2-carbonylamino)-3-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(Nc2ccc(NC(=O)c3ccco3)nc2)c1 |
| InChI | InChI=1S/C18H14ClN3O4/c1-25-18(24)11-4-6-13(19)14(9-11)21-12-5-7-16(20-10-12)22-17(23)15-3-2-8-26-15/h2-10,21H,1H3,(H,20,22,23) |
| InChIKey | PSQQXDVBSRWTJW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |