C17H12F3N3O2 — CID 113034810
N-[5-[2-(trifluoromethyl)anilino]-2-pyridinyl]furan-2-carboxamide (PubChem CID 113034810) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is N-[5-[2-(trifluoromethyl)anilino]-2-pyridinyl]furan-2-carboxamide.
| Compound Name | N-[5-[2-(trifluoromethyl)anilino]-2-pyridinyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113034810 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[5-[2-(trifluoromethyl)anilino]-2-pyridinyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccccc2C(F)(F)F)cn1)c1ccco1 |
| InChI | InChI=1S/C17H12F3N3O2/c18-17(19,20)12-4-1-2-5-13(12)22-11-7-8-15(21-10-11)23-16(24)14-6-3-9-25-14/h1-10,22H,(H,21,23,24) |
| InChIKey | PFGUXPRRMMGHKT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |