C17H11ClF3N3O2 — CID 113035477
N-[5-[2-chloro-5-(trifluoromethyl)anilino]-2-pyridinyl]furan-2-carboxamide (PubChem CID 113035477) has the molecular formula C17H11ClF3N3O2 and a molecular weight of 381.74 g/mol. Its IUPAC name is N-[5-[2-chloro-5-(trifluoromethyl)anilino]-2-pyridinyl]furan-2-carboxamide.
| Compound Name | N-[5-[2-chloro-5-(trifluoromethyl)anilino]-2-pyridinyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113035477 |
| Molecular Formula | C17H11ClF3N3O2 |
| Molecular Weight | 381.74 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | N-[5-[2-chloro-5-(trifluoromethyl)anilino]-2-pyridinyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2cc(C(F)(F)F)ccc2Cl)cn1)c1ccco1 |
| InChI | InChI=1S/C17H11ClF3N3O2/c18-12-5-3-10(17(19,20)21)8-13(12)23-11-4-6-15(22-9-11)24-16(25)14-2-1-7-26-14/h1-9,23H,(H,22,24,25) |
| InChIKey | QUVOVQFHZNIWJW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.74 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |