C18H16ClN3O2 — CID 113033730
N-[5-(2-chloro-4,6-dimethylanilino)-2-pyridinyl]furan-2-carboxamide (PubChem CID 113033730) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is N-[5-(2-chloro-4,6-dimethylanilino)-2-pyridinyl]furan-2-carboxamide.
| Compound Name | N-[5-(2-chloro-4,6-dimethylanilino)-2-pyridinyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113033730 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-[5-(2-chloro-4,6-dimethylanilino)-2-pyridinyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)c(Nc2ccc(NC(=O)c3ccco3)nc2)c(Cl)c1 |
| InChI | InChI=1S/C18H16ClN3O2/c1-11-8-12(2)17(14(19)9-11)21-13-5-6-16(20-10-13)22-18(23)15-4-3-7-24-15/h3-10,21H,1-2H3,(H,20,22,23) |
| InChIKey | XGVSUIPJQRYPPR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |