C21H20ClN3O — CID 113019049
N-[6-(2-chloro-4,6-dimethylanilino)-3-pyridinyl]-2-phenylacetamide (PubChem CID 113019049) has the molecular formula C21H20ClN3O and a molecular weight of 365.86 g/mol. Its IUPAC name is N-[6-(2-chloro-4,6-dimethylanilino)-3-pyridinyl]-2-phenylacetamide.
| Compound Name | N-[6-(2-chloro-4,6-dimethylanilino)-3-pyridinyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 113019049 |
| Molecular Formula | C21H20ClN3O |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-[6-(2-chloro-4,6-dimethylanilino)-3-pyridinyl]-2-phenylacetamide |
| SMILES | Cc1cc(C)c(Nc2ccc(NC(=O)Cc3ccccc3)cn2)c(Cl)c1 |
| InChI | InChI=1S/C21H20ClN3O/c1-14-10-15(2)21(18(22)11-14)25-19-9-8-17(13-23-19)24-20(26)12-16-6-4-3-5-7-16/h3-11,13H,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | VRMGJUKFTPBGEH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |