C20H16ClF2N3O — CID 113019057
N-[6-(2-chloro-4,6-dimethylanilino)-3-pyridinyl]-3,4-difluorobenzamide (PubChem CID 113019057) has the molecular formula C20H16ClF2N3O and a molecular weight of 387.82 g/mol. Its IUPAC name is N-[6-(2-chloro-4,6-dimethylanilino)-3-pyridinyl]-3,4-difluorobenzamide.
| Compound Name | N-[6-(2-chloro-4,6-dimethylanilino)-3-pyridinyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113019057 |
| Molecular Formula | C20H16ClF2N3O |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[6-(2-chloro-4,6-dimethylanilino)-3-pyridinyl]-3,4-difluorobenzamide |
| SMILES | Cc1cc(C)c(Nc2ccc(NC(=O)c3ccc(F)c(F)c3)cn2)c(Cl)c1 |
| InChI | InChI=1S/C20H16ClF2N3O/c1-11-7-12(2)19(15(21)8-11)26-18-6-4-14(10-24-18)25-20(27)13-3-5-16(22)17(23)9-13/h3-10H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | HAPARPTTZFSZCO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |