C22H23N3O2 — CID 113017912
2-phenoxy-N-[6-(2,4,6-trimethylanilino)-3-pyridinyl]acetamide (PubChem CID 113017912) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-phenoxy-N-[6-(2,4,6-trimethylanilino)-3-pyridinyl]acetamide.
| Compound Name | 2-phenoxy-N-[6-(2,4,6-trimethylanilino)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 113017912 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-phenoxy-N-[6-(2,4,6-trimethylanilino)-3-pyridinyl]acetamide |
| SMILES | Cc1cc(C)c(Nc2ccc(NC(=O)COc3ccccc3)cn2)c(C)c1 |
| InChI | InChI=1S/C22H23N3O2/c1-15-11-16(2)22(17(3)12-15)25-20-10-9-18(13-23-20)24-21(26)14-27-19-7-5-4-6-8-19/h4-13H,14H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | HWZAREZSRMIBGH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |