C22H24N4O3 — CID 113047016
2-(2-methoxyphenoxy)-N-[6-(2,4,6-trimethylanilino)pyridazin-3-yl]acetamide (PubChem CID 113047016) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[6-(2,4,6-trimethylanilino)pyridazin-3-yl]acetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-[6-(2,4,6-trimethylanilino)pyridazin-3-yl]acetamide |
|---|---|
| PubChem CID | 113047016 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[6-(2,4,6-trimethylanilino)pyridazin-3-yl]acetamide |
| SMILES | COc1ccccc1OCC(=O)Nc1ccc(Nc2c(C)cc(C)cc2C)nn1 |
| InChI | InChI=1S/C22H24N4O3/c1-14-11-15(2)22(16(3)12-14)24-20-10-9-19(25-26-20)23-21(27)13-29-18-8-6-5-7-17(18)28-4/h5-12H,13H2,1-4H3,(H,24,26)(H,23,25,27) |
| InChIKey | DYUHVFQWGGMSBY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |