C16H10ClF3N4O2 — CID 113050628
N-[6-[4-chloro-3-(trifluoromethyl)anilino]pyridazin-3-yl]furan-2-carboxamide (PubChem CID 113050628) has the molecular formula C16H10ClF3N4O2 and a molecular weight of 382.73 g/mol. Its IUPAC name is N-[6-[4-chloro-3-(trifluoromethyl)anilino]pyridazin-3-yl]furan-2-carboxamide.
| Compound Name | N-[6-[4-chloro-3-(trifluoromethyl)anilino]pyridazin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113050628 |
| Molecular Formula | C16H10ClF3N4O2 |
| Molecular Weight | 382.73 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | N-[6-[4-chloro-3-(trifluoromethyl)anilino]pyridazin-3-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(Cl)c(C(F)(F)F)c2)nn1)c1ccco1 |
| InChI | InChI=1S/C16H10ClF3N4O2/c17-11-4-3-9(8-10(11)16(18,19)20)21-13-5-6-14(24-23-13)22-15(25)12-2-1-7-26-12/h1-8H,(H,21,23)(H,22,24,25) |
| InChIKey | HBAQKOQLZNONTM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.73 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |