C19H21N5O2 — CID 113049661
N-[6-[4-(diethylamino)anilino]pyridazin-3-yl]furan-2-carboxamide (PubChem CID 113049661) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[6-[4-(diethylamino)anilino]pyridazin-3-yl]furan-2-carboxamide.
| Compound Name | N-[6-[4-(diethylamino)anilino]pyridazin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113049661 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[6-[4-(diethylamino)anilino]pyridazin-3-yl]furan-2-carboxamide |
| SMILES | CCN(CC)c1ccc(Nc2ccc(NC(=O)c3ccco3)nn2)cc1 |
| InChI | InChI=1S/C19H21N5O2/c1-3-24(4-2)15-9-7-14(8-10-15)20-17-11-12-18(23-22-17)21-19(25)16-6-5-13-26-16/h5-13H,3-4H2,1-2H3,(H,20,22)(H,21,23,25) |
| InChIKey | YGWAFTCDADXPHM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|