C21H24N6O — CID 109121189
6-[4-(diethylamino)anilino]-N-(pyridin-3-ylmethyl)pyridazine-3-carboxamide (PubChem CID 109121189) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 6-[4-(diethylamino)anilino]-N-(pyridin-3-ylmethyl)pyridazine-3-carboxamide.
| Compound Name | 6-[4-(diethylamino)anilino]-N-(pyridin-3-ylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109121189 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 6-[4-(diethylamino)anilino]-N-(pyridin-3-ylmethyl)pyridazine-3-carboxamide |
| SMILES | CCN(CC)c1ccc(Nc2ccc(C(=O)NCc3cccnc3)nn2)cc1 |
| InChI | InChI=1S/C21H24N6O/c1-3-27(4-2)18-9-7-17(8-10-18)24-20-12-11-19(25-26-20)21(28)23-15-16-6-5-13-22-14-16/h5-14H,3-4,15H2,1-2H3,(H,23,28)(H,24,26) |
| InChIKey | HBPZNONBQXICGV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|