C15H19N5O — CID 109120969
N,N-diethyl-6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide (PubChem CID 109120969) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is N,N-diethyl-6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide.
| Compound Name | N,N-diethyl-6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109120969 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N,N-diethyl-6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(NCc2cccnc2)nn1 |
| InChI | InChI=1S/C15H19N5O/c1-3-20(4-2)15(21)13-7-8-14(19-18-13)17-11-12-6-5-9-16-10-12/h5-10H,3-4,11H2,1-2H3,(H,17,19) |
| InChIKey | VEJHKBFJZYEKSN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |