C17H14BrN5O — CID 109121053
N-(2-bromophenyl)-6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide (PubChem CID 109121053) has the molecular formula C17H14BrN5O and a molecular weight of 384.24 g/mol. Its IUPAC name is N-(2-bromophenyl)-6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide.
| Compound Name | N-(2-bromophenyl)-6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109121053 |
| Molecular Formula | C17H14BrN5O |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | N-(2-bromophenyl)-6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)c1ccc(NCc2cccnc2)nn1 |
| InChI | InChI=1S/C17H14BrN5O/c18-13-5-1-2-6-14(13)21-17(24)15-7-8-16(23-22-15)20-11-12-4-3-9-19-10-12/h1-10H,11H2,(H,20,23)(H,21,24) |
| InChIKey | WYQHLVJCBMGUJT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |