C11H11N5O — CID 79005962
6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide (PubChem CID 79005962) has the molecular formula C11H11N5O and a molecular weight of 229.24 g/mol. Its IUPAC name is 6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide.
| Compound Name | 6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 79005962 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 6-(pyridin-3-ylmethylamino)pyridazine-3-carboxamide |
| SMILES | NC(=O)c1ccc(NCc2cccnc2)nn1 |
| InChI | InChI=1S/C11H11N5O/c12-11(17)9-3-4-10(16-15-9)14-7-8-2-1-5-13-6-8/h1-6H,7H2,(H2,12,17)(H,14,16) |
| InChIKey | MJSQSOGEGZNYMA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |