C19H19N5O2 — CID 109120160
6-[(4-methoxyphenyl)methylamino]-N-(pyridin-3-ylmethyl)pyridazine-3-carboxamide (PubChem CID 109120160) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methylamino]-N-(pyridin-3-ylmethyl)pyridazine-3-carboxamide.
| Compound Name | 6-[(4-methoxyphenyl)methylamino]-N-(pyridin-3-ylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109120160 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 6-[(4-methoxyphenyl)methylamino]-N-(pyridin-3-ylmethyl)pyridazine-3-carboxamide |
| SMILES | COc1ccc(CNc2ccc(C(=O)NCc3cccnc3)nn2)cc1 |
| InChI | InChI=1S/C19H19N5O2/c1-26-16-6-4-14(5-7-16)12-21-18-9-8-17(23-24-18)19(25)22-13-15-3-2-10-20-11-15/h2-11H,12-13H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | JINBJSNEQPKQRL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |