C21H30N6O — CID 113049683
1-cyclohexyl-3-[6-[4-(diethylamino)anilino]pyridazin-3-yl]urea (PubChem CID 113049683) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-cyclohexyl-3-[6-[4-(diethylamino)anilino]pyridazin-3-yl]urea.
| Compound Name | 1-cyclohexyl-3-[6-[4-(diethylamino)anilino]pyridazin-3-yl]urea |
|---|---|
| PubChem CID | 113049683 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 1-cyclohexyl-3-[6-[4-(diethylamino)anilino]pyridazin-3-yl]urea |
| SMILES | CCN(CC)c1ccc(Nc2ccc(NC(=O)NC3CCCCC3)nn2)cc1 |
| InChI | InChI=1S/C21H30N6O/c1-3-27(4-2)18-12-10-17(11-13-18)22-19-14-15-20(26-25-19)24-21(28)23-16-8-6-5-7-9-16/h10-16H,3-9H2,1-2H3,(H,22,25)(H2,23,24,26,28) |
| InChIKey | WYJAFMIPQCMCBI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|