C17H19ClFN5O — CID 113047848
1-[6-(3-chloro-4-fluoroanilino)pyridazin-3-yl]-3-cyclohexylurea (PubChem CID 113047848) has the molecular formula C17H19ClFN5O and a molecular weight of 363.82 g/mol. Its IUPAC name is 1-[6-(3-chloro-4-fluoroanilino)pyridazin-3-yl]-3-cyclohexylurea.
| Compound Name | 1-[6-(3-chloro-4-fluoroanilino)pyridazin-3-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 113047848 |
| Molecular Formula | C17H19ClFN5O |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-[6-(3-chloro-4-fluoroanilino)pyridazin-3-yl]-3-cyclohexylurea |
| SMILES | O=C(Nc1ccc(Nc2ccc(F)c(Cl)c2)nn1)NC1CCCCC1 |
| InChI | InChI=1S/C17H19ClFN5O/c18-13-10-12(6-7-14(13)19)20-15-8-9-16(24-23-15)22-17(25)21-11-4-2-1-3-5-11/h6-11H,1-5H2,(H,20,23)(H2,21,22,24,25) |
| InChIKey | QVGBFZROVHPYPP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |