C14H13Cl2N5O — CID 113050834
1-cyclopropyl-3-[6-(2,5-dichloroanilino)pyridazin-3-yl]urea (PubChem CID 113050834) has the molecular formula C14H13Cl2N5O and a molecular weight of 338.20 g/mol. Its IUPAC name is 1-cyclopropyl-3-[6-(2,5-dichloroanilino)pyridazin-3-yl]urea.
| Compound Name | 1-cyclopropyl-3-[6-(2,5-dichloroanilino)pyridazin-3-yl]urea |
|---|---|
| PubChem CID | 113050834 |
| Molecular Formula | C14H13Cl2N5O |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 1-cyclopropyl-3-[6-(2,5-dichloroanilino)pyridazin-3-yl]urea |
| SMILES | O=C(Nc1ccc(Nc2cc(Cl)ccc2Cl)nn1)NC1CC1 |
| InChI | InChI=1S/C14H13Cl2N5O/c15-8-1-4-10(16)11(7-8)18-12-5-6-13(21-20-12)19-14(22)17-9-2-3-9/h1,4-7,9H,2-3H2,(H,18,20)(H2,17,19,21,22) |
| InChIKey | BMPDMJZUUJYQGU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |