C17H18F3N5O — CID 113051505
1-cyclohexyl-3-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]urea (PubChem CID 113051505) has the molecular formula C17H18F3N5O and a molecular weight of 365.36 g/mol. Its IUPAC name is 1-cyclohexyl-3-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]urea.
| Compound Name | 1-cyclohexyl-3-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]urea |
|---|---|
| PubChem CID | 113051505 |
| Molecular Formula | C17H18F3N5O |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-cyclohexyl-3-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]urea |
| SMILES | O=C(Nc1ccc(Nc2ccc(F)c(F)c2F)nn1)NC1CCCCC1 |
| InChI | InChI=1S/C17H18F3N5O/c18-11-6-7-12(16(20)15(11)19)22-13-8-9-14(25-24-13)23-17(26)21-10-4-2-1-3-5-10/h6-10H,1-5H2,(H,22,24)(H2,21,23,25,26) |
| InChIKey | RIYZHHHPNMNFTE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|