C17H20ClN5O — CID 113047482
1-[6-(3-chloroanilino)pyridazin-3-yl]-3-cyclohexylurea (PubChem CID 113047482) has the molecular formula C17H20ClN5O and a molecular weight of 345.83 g/mol. Its IUPAC name is 1-[6-(3-chloroanilino)pyridazin-3-yl]-3-cyclohexylurea.
| Compound Name | 1-[6-(3-chloroanilino)pyridazin-3-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 113047482 |
| Molecular Formula | C17H20ClN5O |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-[6-(3-chloroanilino)pyridazin-3-yl]-3-cyclohexylurea |
| SMILES | O=C(Nc1ccc(Nc2cccc(Cl)c2)nn1)NC1CCCCC1 |
| InChI | InChI=1S/C17H20ClN5O/c18-12-5-4-8-14(11-12)19-15-9-10-16(23-22-15)21-17(24)20-13-6-2-1-3-7-13/h4-5,8-11,13H,1-3,6-7H2,(H,19,22)(H2,20,21,23,24) |
| InChIKey | PFDXRFDXYJQOPU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |