C14H14ClN5O — CID 113047575
1-[6-(4-chloroanilino)pyridazin-3-yl]-3-cyclopropylurea (PubChem CID 113047575) has the molecular formula C14H14ClN5O and a molecular weight of 303.75 g/mol. Its IUPAC name is 1-[6-(4-chloroanilino)pyridazin-3-yl]-3-cyclopropylurea.
| Compound Name | 1-[6-(4-chloroanilino)pyridazin-3-yl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 113047575 |
| Molecular Formula | C14H14ClN5O |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-[6-(4-chloroanilino)pyridazin-3-yl]-3-cyclopropylurea |
| SMILES | O=C(Nc1ccc(Nc2ccc(Cl)cc2)nn1)NC1CC1 |
| InChI | InChI=1S/C14H14ClN5O/c15-9-1-3-10(4-2-9)16-12-7-8-13(20-19-12)18-14(21)17-11-5-6-11/h1-4,7-8,11H,5-6H2,(H,16,19)(H2,17,18,20,21) |
| InChIKey | OUZZUBALVGXTTA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |