C16H20N6O — CID 113049629
1-cyclopropyl-3-[6-[4-(dimethylamino)anilino]pyridazin-3-yl]urea (PubChem CID 113049629) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-cyclopropyl-3-[6-[4-(dimethylamino)anilino]pyridazin-3-yl]urea.
| Compound Name | 1-cyclopropyl-3-[6-[4-(dimethylamino)anilino]pyridazin-3-yl]urea |
|---|---|
| PubChem CID | 113049629 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-cyclopropyl-3-[6-[4-(dimethylamino)anilino]pyridazin-3-yl]urea |
| SMILES | CN(C)c1ccc(Nc2ccc(NC(=O)NC3CC3)nn2)cc1 |
| InChI | InChI=1S/C16H20N6O/c1-22(2)13-7-5-11(6-8-13)17-14-9-10-15(21-20-14)19-16(23)18-12-3-4-12/h5-10,12H,3-4H2,1-2H3,(H,17,20)(H2,18,19,21,23) |
| InChIKey | QEDQAIYXGMFDBV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|