C12H13F3N2S — CID 116507277
1-cyclopentyl-3-(2,3,4-trifluorophenyl)thiourea (PubChem CID 116507277) has the molecular formula C12H13F3N2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,3,4-trifluorophenyl)thiourea.
| Compound Name | 1-cyclopentyl-3-(2,3,4-trifluorophenyl)thiourea |
|---|---|
| PubChem CID | 116507277 |
| Molecular Formula | C12H13F3N2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-cyclopentyl-3-(2,3,4-trifluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)NC2CCCC2)c(F)c1F |
| InChI | InChI=1S/C12H13F3N2S/c13-8-5-6-9(11(15)10(8)14)17-12(18)16-7-3-1-2-4-7/h5-7H,1-4H2,(H2,16,17,18) |
| InChIKey | SWFAAVVKIHOYPI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|