C10H11F3N2S — CID 7991832
1-propan-2-yl-3-(2,3,4-trifluorophenyl)thiourea (PubChem CID 7991832) has the molecular formula C10H11F3N2S and a molecular weight of 248.27 g/mol. Its IUPAC name is 1-propan-2-yl-3-(2,3,4-trifluorophenyl)thiourea.
| Compound Name | 1-propan-2-yl-3-(2,3,4-trifluorophenyl)thiourea |
|---|---|
| PubChem CID | 7991832 |
| Molecular Formula | C10H11F3N2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 1-propan-2-yl-3-(2,3,4-trifluorophenyl)thiourea |
| SMILES | CC(C)NC(=S)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H11F3N2S/c1-5(2)14-10(16)15-7-4-3-6(11)8(12)9(7)13/h3-5H,1-2H3,(H2,14,15,16) |
| InChIKey | ZUZGHAMGDWCVTP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|