C10H9F3N2O3 — CID 28508673
(2S)-2-[(2,3,4-trifluorophenyl)carbamoylamino]propanoic acid (PubChem CID 28508673) has the molecular formula C10H9F3N2O3 and a molecular weight of 262.19 g/mol. Its IUPAC name is (2S)-2-[(2,3,4-trifluorophenyl)carbamoylamino]propanoic acid.
| Compound Name | (2S)-2-[(2,3,4-trifluorophenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 28508673 |
| Molecular Formula | C10H9F3N2O3 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (2S)-2-[(2,3,4-trifluorophenyl)carbamoylamino]propanoic acid |
| SMILES | C[C@H](NC(=O)Nc1ccc(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C10H9F3N2O3/c1-4(9(16)17)14-10(18)15-6-3-2-5(11)7(12)8(6)13/h2-4H,1H3,(H,16,17)(H2,14,15,18)/t4-/m0/s1 |
| InChIKey | JTZMBJFLVZRSKK-BYPYZUCNSA-N |
| XLogP | 1.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|