C11H11F3N2O2 — CID 47224066
N'-propan-2-yl-N-(2,3,4-trifluorophenyl)oxamide (PubChem CID 47224066) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is N'-propan-2-yl-N-(2,3,4-trifluorophenyl)oxamide.
| Compound Name | N'-propan-2-yl-N-(2,3,4-trifluorophenyl)oxamide |
|---|---|
| PubChem CID | 47224066 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N'-propan-2-yl-N-(2,3,4-trifluorophenyl)oxamide |
| SMILES | CC(C)NC(=O)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H11F3N2O2/c1-5(2)15-10(17)11(18)16-7-4-3-6(12)8(13)9(7)14/h3-5H,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | URQXFMCGXQEEAA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|