C10H11F3N2O — CID 47173418
1-propan-2-yl-3-(2,3,4-trifluorophenyl)urea (PubChem CID 47173418) has the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. Its IUPAC name is 1-propan-2-yl-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-propan-2-yl-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 47173418 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-propan-2-yl-3-(2,3,4-trifluorophenyl)urea |
| SMILES | CC(C)NC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H11F3N2O/c1-5(2)14-10(16)15-7-4-3-6(11)8(12)9(7)13/h3-5H,1-2H3,(H2,14,15,16) |
| InChIKey | XJDSAJIQZTWDLJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|