C13H17F3N2O2 — CID 111472896
1-(3-hydroxy-4-methylpentyl)-3-(2,3,4-trifluorophenyl)urea (PubChem CID 111472896) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 1-(3-hydroxy-4-methylpentyl)-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-(3-hydroxy-4-methylpentyl)-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 111472896 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-(3-hydroxy-4-methylpentyl)-3-(2,3,4-trifluorophenyl)urea |
| SMILES | CC(C)C(O)CCNC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H17F3N2O2/c1-7(2)10(19)5-6-17-13(20)18-9-4-3-8(14)11(15)12(9)16/h3-4,7,10,19H,5-6H2,1-2H3,(H2,17,18,20) |
| InChIKey | JIFJNZKJXRHPCE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|