C13H15F4NO2 — CID 111460606
2,3,4,5-tetrafluoro-N-(3-hydroxy-4-methylpentyl)benzamide (PubChem CID 111460606) has the molecular formula C13H15F4NO2 and a molecular weight of 293.26 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-(3-hydroxy-4-methylpentyl)benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-(3-hydroxy-4-methylpentyl)benzamide |
|---|---|
| PubChem CID | 111460606 |
| Molecular Formula | C13H15F4NO2 |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-(3-hydroxy-4-methylpentyl)benzamide |
| SMILES | CC(C)C(O)CCNC(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H15F4NO2/c1-6(2)9(19)3-4-18-13(20)7-5-8(14)11(16)12(17)10(7)15/h5-6,9,19H,3-4H2,1-2H3,(H,18,20) |
| InChIKey | ZICXXPTVZDIYKQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|