C27H18F12N4O3 — CID 139198554
N-[2-[bis[2-[(2,3,4,5-tetrafluorobenzoyl)amino]ethyl]amino]ethyl]-2,3,4,5-tetrafluorobenzamide (PubChem CID 139198554) has the molecular formula C27H18F12N4O3 and a molecular weight of 674.44 g/mol. Its IUPAC name is N-[2-[bis[2-[(2,3,4,5-tetrafluorobenzoyl)amino]ethyl]amino]ethyl]-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-[2-[bis[2-[(2,3,4,5-tetrafluorobenzoyl)amino]ethyl]amino]ethyl]-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 139198554 |
| Molecular Formula | C27H18F12N4O3 |
| Molecular Weight | 674.44 g/mol |
| Exact Mass | 674.12 |
| IUPAC Name | N-[2-[bis[2-[(2,3,4,5-tetrafluorobenzoyl)amino]ethyl]amino]ethyl]-2,3,4,5-tetrafluorobenzamide |
| SMILES | O=C(NCCN(CCNC(=O)c1cc(F)c(F)c(F)c1F)CCNC(=O)c1cc(F)c(F)c(F)c1F)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H18F12N4O3/c28-13-7-10(16(31)22(37)19(13)34)25(44)40-1-4-43(5-2-41-26(45)11-8-14(29)20(35)23(38)17(11)32)6-3-42-27(46)12-9-15(30)21(36)24(39)18(12)33/h7-9H,1-6H2,(H,40,44)(H,41,45)(H,42,46) |
| InChIKey | XLKMYLDTJDGTMA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|