C12H10F4N4O — CID 64547700
2,3,4,5-tetrafluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide (PubChem CID 64547700) has the molecular formula C12H10F4N4O and a molecular weight of 302.23 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide |
|---|---|
| PubChem CID | 64547700 |
| Molecular Formula | C12H10F4N4O |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide |
| SMILES | O=C(NCCCc1ncn[nH]1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H10F4N4O/c13-7-4-6(9(14)11(16)10(7)15)12(21)17-3-1-2-8-18-5-19-20-8/h4-5H,1-3H2,(H,17,21)(H,18,19,20) |
| InChIKey | OVHXLAVIGLBEGQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|